C19H24O12 — CID 11004767
bis[(2S)-1,4-dimethoxy-1,4-dioxobutan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 11004767) has the molecular formula C19H24O12 and a molecular weight of 444.39 g/mol. Its IUPAC name is bis[(2S)-1,4-dimethoxy-1,4-dioxobutan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | bis[(2S)-1,4-dimethoxy-1,4-dioxobutan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11004767 |
| Molecular Formula | C19H24O12 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | bis[(2S)-1,4-dimethoxy-1,4-dioxobutan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | COC(=O)C[C@H](OC(=O)C1=C(C(=O)O[C@@H](CC(=O)OC)C(=O)OC)C1(C)C)C(=O)OC |
| InChI | InChI=1S/C19H24O12/c1-19(2)13(17(24)30-9(15(22)28-5)7-11(20)26-3)14(19)18(25)31-10(16(23)29-6)8-12(21)27-4/h9-10H,7-8H2,1-6H3/t9-,10-/m0/s1 |
| InChIKey | LOTMMWAVXFZJLJ-UWVGGRQHSA-N |
| XLogP | -0.38 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|