C19H28O8 — CID 11090288
bis[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 11090288) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is bis[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | bis[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11090288 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | bis[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@H](C)OC(=O)C1=C(C(=O)O[C@@H](C)C(=O)OC(C)C)C1(C)C |
| InChI | InChI=1S/C19H28O8/c1-9(2)24-15(20)11(5)26-17(22)13-14(19(13,7)8)18(23)27-12(6)16(21)25-10(3)4/h9-12H,1-8H3/t11-,12-/m0/s1 |
| InChIKey | PGPYCSZYPSCNJW-RYUDHWBXSA-N |
| XLogP | 2.09 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|