C21H32O8 — CID 11825788
bis[(2R)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 11825788) has the molecular formula C21H32O8 and a molecular weight of 412.48 g/mol. Its IUPAC name is bis[(2R)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | bis[(2R)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11825788 |
| Molecular Formula | C21H32O8 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | bis[(2R)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | C[C@@H](OC(=O)C1=C(C(=O)O[C@H](C)C(=O)OC(C)(C)C)C1(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32O8/c1-11(15(22)28-19(3,4)5)26-17(24)13-14(21(13,9)10)18(25)27-12(2)16(23)29-20(6,7)8/h11-12H,1-10H3/t11-,12-/m1/s1 |
| InChIKey | UDMIYXMGLUSJGG-VXGBXAGGSA-N |
| XLogP | 2.87 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|