C12H16O6 — CID 148587949
2-ethoxyethyl 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate (PubChem CID 148587949) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-ethoxyethyl 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate.
| Compound Name | 2-ethoxyethyl 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
|---|---|
| PubChem CID | 148587949 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-ethoxyethyl 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
| SMILES | CCOCCOC(=O)CCC1=C(C)C(=O)OC1=O |
| InChI | InChI=1S/C12H16O6/c1-3-16-6-7-17-10(13)5-4-9-8(2)11(14)18-12(9)15/h3-7H2,1-2H3 |
| InChIKey | NABPMXSIWKDNAZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|