C11H10O5 — CID 163781203
prop-2-ynyl 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate (PubChem CID 163781203) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is prop-2-ynyl 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate.
| Compound Name | prop-2-ynyl 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
|---|---|
| PubChem CID | 163781203 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | prop-2-ynyl 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
| SMILES | C#CCOC(=O)CCC1=C(C)C(=O)OC1=O |
| InChI | InChI=1S/C11H10O5/c1-3-6-15-9(12)5-4-8-7(2)10(13)16-11(8)14/h1H,4-6H2,2H3 |
| InChIKey | MOSZAYUCFWBPSH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|