C8H7IO3 — CID 141342979
methyl 3-iodo-4-oxocyclohexa-1,5-diene-1-carboxylate (PubChem CID 141342979) has the molecular formula C8H7IO3 and a molecular weight of 278.05 g/mol. Its IUPAC name is methyl 3-iodo-4-oxocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 3-iodo-4-oxocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 141342979 |
| Molecular Formula | C8H7IO3 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | methyl 3-iodo-4-oxocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(I)C(=O)C=C1 |
| InChI | InChI=1S/C8H7IO3/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4,6H,1H3 |
| InChIKey | PRXRFQMJCXGRKP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|