About methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate
methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate (PubChem CID 134945864) has the molecular formula C12H10O4
and a molecular weight of 218.21 g/mol. Its IUPAC name is methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate.
Analyze methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate?
The IUPAC name of methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate (CID 134945864) is methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate.
What is the SMILES notation for methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate?
The canonical SMILES for methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate is COC(=O)C1=CC2C3C(=O)C=CC(=O)C3C12.
What is the InChIKey of methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate?
The InChIKey is KHVRDTUUJUWQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4/c1-16-12(15)6-4-5-9(6)11-8(14)3-2-7(13)10(5)11/h2-5,9-11H,1H3.
What are the key properties of methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate?
methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate has a molecular weight of 218.21 g/mol, XLogP of 0.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7,10-dioxotricyclo[4.4.0.02,5]deca-3,8-diene-3-carboxylate is sourced from PubChem (CID 134945864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).