C11H12O3 — CID 123984218
methyl 3-formyl-5-methylcyclohepta-1,3,6-triene-1-carboxylate (PubChem CID 123984218) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is methyl 3-formyl-5-methylcyclohepta-1,3,6-triene-1-carboxylate.
| Compound Name | methyl 3-formyl-5-methylcyclohepta-1,3,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 123984218 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | methyl 3-formyl-5-methylcyclohepta-1,3,6-triene-1-carboxylate |
| SMILES | COC(=O)C1=CC(C=O)=CC(C)C=C1 |
| InChI | InChI=1S/C11H12O3/c1-8-3-4-10(11(13)14-2)6-9(5-8)7-12/h3-8H,1-2H3 |
| InChIKey | LRAQJMXPAIBCHV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|