About 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine
6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine (PubChem CID 142843918) has the molecular formula C17H27NO3
and a molecular weight of 293.41 g/mol. Its IUPAC name is 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine |
| PubChem CID | 142843918 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine |
| SMILES | CC1C=CC(C=O)=CC(C(=O)O)=C1.CCCN(C)CCC |
| InChI | InChI=1S/C10H10O3.C7H17N/c1-7-2-3-8(6-11)5-9(4-7)10(12)13;1-4-6-8(3)7-5-2/h2-7H,1H3,(H,12,13);4-7H2,1-3H3 |
| InChIKey | NOUQOROCNLVOOZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine?
The IUPAC name of 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine (CID 142843918) is 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine.
What is the SMILES notation for 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine?
The canonical SMILES for 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine is CC1C=CC(C=O)=CC(C(=O)O)=C1.CCCN(C)CCC.
What is the InChIKey of 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine?
The InChIKey is NOUQOROCNLVOOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3.C7H17N/c1-7-2-3-8(6-11)5-9(4-7)10(12)13;1-4-6-8(3)7-5-2/h2-7H,1H3,(H,12,13);4-7H2,1-3H3.
What are the key properties of 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine?
6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine has a molecular weight of 293.41 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-formyl-3-methylcyclohepta-1,4,6-triene-1-carboxylic acid;N-methyl-N-propylpropan-1-amine is sourced from PubChem (CID 142843918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).