C22H25NO3Se — CID 56927653
methyl (2R,3S)-1-benzyl-2-ethoxy-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate (PubChem CID 56927653) has the molecular formula C22H25NO3Se and a molecular weight of 430.41 g/mol. Its IUPAC name is methyl (2R,3S)-1-benzyl-2-ethoxy-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl (2R,3S)-1-benzyl-2-ethoxy-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 56927653 |
| Molecular Formula | C22H25NO3Se |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | methyl (2R,3S)-1-benzyl-2-ethoxy-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCO[C@@H]1[C@@H]([Se]c2ccccc2)CC(C(=O)OC)=CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H25NO3Se/c1-3-26-21-20(27-19-12-8-5-9-13-19)14-18(22(24)25-2)16-23(21)15-17-10-6-4-7-11-17/h4-13,16,20-21H,3,14-15H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | HKOXZADCNSSGSI-LEWJYISDSA-N |
| XLogP | 3.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|