C20H21NO3Se — CID 56927649
methyl (2R,3S)-1-benzyl-2-hydroxy-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate (PubChem CID 56927649) has the molecular formula C20H21NO3Se and a molecular weight of 402.35 g/mol. Its IUPAC name is methyl (2R,3S)-1-benzyl-2-hydroxy-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl (2R,3S)-1-benzyl-2-hydroxy-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 56927649 |
| Molecular Formula | C20H21NO3Se |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | methyl (2R,3S)-1-benzyl-2-hydroxy-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=CN(Cc2ccccc2)[C@H](O)[C@@H]([Se]c2ccccc2)C1 |
| InChI | InChI=1S/C20H21NO3Se/c1-24-20(23)16-12-18(25-17-10-6-3-7-11-17)19(22)21(14-16)13-15-8-4-2-5-9-15/h2-11,14,18-19,22H,12-13H2,1H3/t18-,19+/m0/s1 |
| InChIKey | CLYOQFDNNNMHFM-RBUKOAKNSA-N |
| XLogP | 2.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|