C14H17NO3Se — CID 56927623
methyl (2R,3S)-2-hydroxy-1-methyl-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate (PubChem CID 56927623) has the molecular formula C14H17NO3Se and a molecular weight of 326.25 g/mol. Its IUPAC name is methyl (2R,3S)-2-hydroxy-1-methyl-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl (2R,3S)-2-hydroxy-1-methyl-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 56927623 |
| Molecular Formula | C14H17NO3Se |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | methyl (2R,3S)-2-hydroxy-1-methyl-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=CN(C)[C@H](O)[C@@H]([Se]c2ccccc2)C1 |
| InChI | InChI=1S/C14H17NO3Se/c1-15-9-10(14(17)18-2)8-12(13(15)16)19-11-6-4-3-5-7-11/h3-7,9,12-13,16H,8H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | PVEFLVFWIMLZGF-QWHCGFSZSA-N |
| XLogP | 0.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|