C20H27NO4Se — CID 10645986
8-O-tert-butyl 2-O-methyl (1R,2R,5S)-3-phenylselanyl-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (PubChem CID 10645986) has the molecular formula C20H27NO4Se and a molecular weight of 424.40 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl (1R,2R,5S)-3-phenylselanyl-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl (1R,2R,5S)-3-phenylselanyl-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
|---|---|
| PubChem CID | 10645986 |
| Molecular Formula | C20H27NO4Se |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl (1R,2R,5S)-3-phenylselanyl-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C([Se]c2ccccc2)C[C@@H]2CC[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27NO4Se/c1-20(2,3)25-19(23)21-13-10-11-15(21)17(18(22)24-4)16(12-13)26-14-8-6-5-7-9-14/h5-9,13,15-17H,10-12H2,1-4H3/t13-,15+,16?,17-/m0/s1 |
| InChIKey | LPTZQLORWKDUPY-YZKFAUGJSA-N |
| XLogP | 2.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|