C21H28INO4 — CID 21339696
8-O-tert-butyl 2-O-methyl 3-(3-iodo-4-methylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (PubChem CID 21339696) has the molecular formula C21H28INO4 and a molecular weight of 485.36 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl 3-(3-iodo-4-methylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl 3-(3-iodo-4-methylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
|---|---|
| PubChem CID | 21339696 |
| Molecular Formula | C21H28INO4 |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl 3-(3-iodo-4-methylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| SMILES | COC(=O)C1C(c2ccc(C)c(I)c2)CC2CCC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28INO4/c1-12-6-7-13(10-16(12)22)15-11-14-8-9-17(18(15)19(24)26-5)23(14)20(25)27-21(2,3)4/h6-7,10,14-15,17-18H,8-9,11H2,1-5H3 |
| InChIKey | RCFFHZOIDCJGPW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|