C20H24Cl3NO4 — CID 10503662
2-O-methyl 8-O-(2,2,2-trichloroethyl) (1R,2S,3S,5S)-3-(4-ethylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (PubChem CID 10503662) has the molecular formula C20H24Cl3NO4 and a molecular weight of 448.77 g/mol. Its IUPAC name is 2-O-methyl 8-O-(2,2,2-trichloroethyl) (1R,2S,3S,5S)-3-(4-ethylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate.
| Compound Name | 2-O-methyl 8-O-(2,2,2-trichloroethyl) (1R,2S,3S,5S)-3-(4-ethylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
|---|---|
| PubChem CID | 10503662 |
| Molecular Formula | C20H24Cl3NO4 |
| Molecular Weight | 448.77 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 2-O-methyl 8-O-(2,2,2-trichloroethyl) (1R,2S,3S,5S)-3-(4-ethylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| SMILES | CCc1ccc([C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)OC)N3C(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H24Cl3NO4/c1-3-12-4-6-13(7-5-12)15-10-14-8-9-16(17(15)18(25)27-2)24(14)19(26)28-11-20(21,22)23/h4-7,14-17H,3,8-11H2,1-2H3/t14-,15+,16+,17-/m0/s1 |
| InChIKey | OXUDADPVYWCUTI-HZMVEIRTSA-N |
| XLogP | 4.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.77 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|