C23H20O3Se — CID 132850687
methyl (3R,4S)-4-phenyl-3-phenylselanyl-3,4-dihydro-2H-chromene-6-carboxylate (PubChem CID 132850687) has the molecular formula C23H20O3Se and a molecular weight of 423.37 g/mol. Its IUPAC name is methyl (3R,4S)-4-phenyl-3-phenylselanyl-3,4-dihydro-2H-chromene-6-carboxylate.
| Compound Name | methyl (3R,4S)-4-phenyl-3-phenylselanyl-3,4-dihydro-2H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 132850687 |
| Molecular Formula | C23H20O3Se |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | methyl (3R,4S)-4-phenyl-3-phenylselanyl-3,4-dihydro-2H-chromene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H](c1ccccc1)[C@@H]([Se]c1ccccc1)CO2 |
| InChI | InChI=1S/C23H20O3Se/c1-25-23(24)17-12-13-20-19(14-17)22(16-8-4-2-5-9-16)21(15-26-20)27-18-10-6-3-7-11-18/h2-14,21-22H,15H2,1H3/t21-,22-/m0/s1 |
| InChIKey | NWFVZJMBNBXQSW-VXKWHMMOSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|