About methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate
methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate (PubChem CID 10339495) has the molecular formula C23H20O3S
and a molecular weight of 376.48 g/mol. Its IUPAC name is methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate |
| PubChem CID | 10339495 |
| Molecular Formula | C23H20O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(SCc1ccccc1)c1ccccc1CO2 |
| InChI | InChI=1S/C23H20O3S/c1-25-23(24)17-11-12-21-20(13-17)22(27-15-16-7-3-2-4-8-16)19-10-6-5-9-18(19)14-26-21/h2-13,22H,14-15H2,1H3 |
| InChIKey | NEJZUQPUFIHAMW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate?
The IUPAC name of methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate (CID 10339495) is methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate.
What is the SMILES notation for methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate?
The canonical SMILES for methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate is COC(=O)c1ccc2c(c1)C(SCc1ccccc1)c1ccccc1CO2.
What is the InChIKey of methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate?
The InChIKey is NEJZUQPUFIHAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20O3S/c1-25-23(24)17-11-12-21-20(13-17)22(27-15-16-7-3-2-4-8-16)19-10-6-5-9-18(19)14-26-21/h2-13,22H,14-15H2,1H3.
What are the key properties of methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate?
methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate has a molecular weight of 376.48 g/mol, XLogP of 5.39, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate is sourced from PubChem (CID 10339495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).