C15H19NO3Se — CID 56927624
methyl (2R,3S)-2-methoxy-1-methyl-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate (PubChem CID 56927624) has the molecular formula C15H19NO3Se and a molecular weight of 340.28 g/mol. Its IUPAC name is methyl (2R,3S)-2-methoxy-1-methyl-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl (2R,3S)-2-methoxy-1-methyl-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 56927624 |
| Molecular Formula | C15H19NO3Se |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | methyl (2R,3S)-2-methoxy-1-methyl-3-phenylselanyl-3,4-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=CN(C)[C@H](OC)[C@@H]([Se]c2ccccc2)C1 |
| InChI | InChI=1S/C15H19NO3Se/c1-16-10-11(15(17)19-3)9-13(14(16)18-2)20-12-7-5-4-6-8-12/h4-8,10,13-14H,9H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | IZZLSEKSHVLCLK-UONOGXRCSA-N |
| XLogP | 1.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|