methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate

C9H14O4S — CID 10398480

IUPACmethyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate
SMILESCCOC1CSC(C(=O)OC)=C(C)O1
InChIInChI=1S/C9H14O4S/c1-4-12-7-5-14-8(6(2)13-7)9(10)11-3/h7H,4-5H2,1-3H3
InChIKeyZIEUYJAZPDUWNE-UHFFFAOYSA-N
MW218.27 g/mol
LogP1.52
Rot. Bonds3

About methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate

methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate (PubChem CID 10398480) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate
PubChem CID10398480
Molecular FormulaC9H14O4S
Molecular Weight218.27 g/mol
Exact Mass218.06
IUPAC Namemethyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate
SMILESCCOC1CSC(C(=O)OC)=C(C)O1
InChIInChI=1S/C9H14O4S/c1-4-12-7-5-14-8(6(2)13-7)9(10)11-3/h7H,4-5H2,1-3H3
InChIKeyZIEUYJAZPDUWNE-UHFFFAOYSA-N
XLogP1.52
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.27
LogP ≤ 51.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate?
The IUPAC name of methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate (CID 10398480) is methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate.
What is the SMILES notation for methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate?
The canonical SMILES for methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate is CCOC1CSC(C(=O)OC)=C(C)O1.
What is the InChIKey of methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate?
The InChIKey is ZIEUYJAZPDUWNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S/c1-4-12-7-5-14-8(6(2)13-7)9(10)11-3/h7H,4-5H2,1-3H3.
What are the key properties of methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate?
methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate has a molecular weight of 218.27 g/mol, XLogP of 1.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate is sourced from PubChem (CID 10398480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).