About methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate
methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate (PubChem CID 10398480) has the molecular formula C9H14O4S
and a molecular weight of 218.27 g/mol. Its IUPAC name is methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate.
Analyze methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate?
The IUPAC name of methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate (CID 10398480) is methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate.
What is the SMILES notation for methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate?
The canonical SMILES for methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate is CCOC1CSC(C(=O)OC)=C(C)O1.
What is the InChIKey of methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate?
The InChIKey is ZIEUYJAZPDUWNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S/c1-4-12-7-5-14-8(6(2)13-7)9(10)11-3/h7H,4-5H2,1-3H3.
What are the key properties of methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate?
methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate has a molecular weight of 218.27 g/mol, XLogP of 1.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylate is sourced from PubChem (CID 10398480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).