C9H12O4S — CID 102396777
methyl (4aR,7aR)-3-methyl-4a,6,7,7a-tetrahydrofuro[2,3-b][1,4]oxathiine-2-carboxylate (PubChem CID 102396777) has the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. Its IUPAC name is methyl (4aR,7aR)-3-methyl-4a,6,7,7a-tetrahydrofuro[2,3-b][1,4]oxathiine-2-carboxylate.
| Compound Name | methyl (4aR,7aR)-3-methyl-4a,6,7,7a-tetrahydrofuro[2,3-b][1,4]oxathiine-2-carboxylate |
|---|---|
| PubChem CID | 102396777 |
| Molecular Formula | C9H12O4S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | methyl (4aR,7aR)-3-methyl-4a,6,7,7a-tetrahydrofuro[2,3-b][1,4]oxathiine-2-carboxylate |
| SMILES | COC(=O)C1=C(C)O[C@H]2OCC[C@H]2S1 |
| InChI | InChI=1S/C9H12O4S/c1-5-7(8(10)11-2)14-6-3-4-12-9(6)13-5/h6,9H,3-4H2,1-2H3/t6-,9-/m1/s1 |
| InChIKey | ISNCFIZBRFKCTE-HZGVNTEJSA-N |
| XLogP | 1.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |