C10H12O4S — CID 10398877
methyl (Z)-3-(4-acetyl-5-methyl-1,3-oxathiol-2-yl)prop-2-enoate (PubChem CID 10398877) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is methyl (Z)-3-(4-acetyl-5-methyl-1,3-oxathiol-2-yl)prop-2-enoate.
| Compound Name | methyl (Z)-3-(4-acetyl-5-methyl-1,3-oxathiol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 10398877 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | methyl (Z)-3-(4-acetyl-5-methyl-1,3-oxathiol-2-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C\C1OC(C)=C(C(C)=O)S1 |
| InChI | InChI=1S/C10H12O4S/c1-6(11)10-7(2)14-9(15-10)5-4-8(12)13-3/h4-5,9H,1-3H3/b5-4- |
| InChIKey | SSLRERCVCUOBDK-PLNGDYQASA-N |
| XLogP | 1.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|