C10H14N2O3S — CID 164544883
methyl 4-amino-5-[[(2S)-oxetan-2-yl]methylamino]thiophene-2-carboxylate (PubChem CID 164544883) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is methyl 4-amino-5-[[(2S)-oxetan-2-yl]methylamino]thiophene-2-carboxylate.
| Compound Name | methyl 4-amino-5-[[(2S)-oxetan-2-yl]methylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 164544883 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | methyl 4-amino-5-[[(2S)-oxetan-2-yl]methylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(N)c(NC[C@@H]2CCO2)s1 |
| InChI | InChI=1S/C10H14N2O3S/c1-14-10(13)8-4-7(11)9(16-8)12-5-6-2-3-15-6/h4,6,12H,2-3,5,11H2,1H3/t6-/m0/s1 |
| InChIKey | CTHQFYFFKJKLDL-LURJTMIESA-N |
| XLogP | 1.32 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |