C11H15N3O3 — CID 163570552
methyl 5-amino-4-(oxetan-2-ylmethylamino)pyridine-2-carboxylate (PubChem CID 163570552) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is methyl 5-amino-4-(oxetan-2-ylmethylamino)pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-4-(oxetan-2-ylmethylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 163570552 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | methyl 5-amino-4-(oxetan-2-ylmethylamino)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NCC2CCO2)c(N)cn1 |
| InChI | InChI=1S/C11H15N3O3/c1-16-11(15)10-4-9(8(12)6-14-10)13-5-7-2-3-17-7/h4,6-7H,2-3,5,12H2,1H3,(H,13,14) |
| InChIKey | FYYQXLCXSLQWBX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |