C9H12BrN3O — CID 167002967
6-bromo-3-N-[[(2S)-oxetan-2-yl]methyl]pyridine-3,4-diamine (PubChem CID 167002967) has the molecular formula C9H12BrN3O and a molecular weight of 258.12 g/mol. Its IUPAC name is 6-bromo-3-N-[[(2S)-oxetan-2-yl]methyl]pyridine-3,4-diamine.
| Compound Name | 6-bromo-3-N-[[(2S)-oxetan-2-yl]methyl]pyridine-3,4-diamine |
|---|---|
| PubChem CID | 167002967 |
| Molecular Formula | C9H12BrN3O |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 6-bromo-3-N-[[(2S)-oxetan-2-yl]methyl]pyridine-3,4-diamine |
| SMILES | Nc1cc(Br)ncc1NC[C@@H]1CCO1 |
| InChI | InChI=1S/C9H12BrN3O/c10-9-3-7(11)8(5-13-9)12-4-6-1-2-14-6/h3,5-6,12H,1-2,4H2,(H2,11,13)/t6-/m0/s1 |
| InChIKey | MJZVOQNSDVPHMW-LURJTMIESA-N |
| XLogP | 1.63 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|