C10H14N2O — CID 175517445
2-N-[[(2S)-oxetan-2-yl]methyl]benzene-1,2-diamine (PubChem CID 175517445) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-N-[[(2S)-oxetan-2-yl]methyl]benzene-1,2-diamine.
| Compound Name | 2-N-[[(2S)-oxetan-2-yl]methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 175517445 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-N-[[(2S)-oxetan-2-yl]methyl]benzene-1,2-diamine |
| SMILES | Nc1ccccc1NC[C@@H]1CCO1 |
| InChI | InChI=1S/C10H14N2O/c11-9-3-1-2-4-10(9)12-7-8-5-6-13-8/h1-4,8,12H,5-7,11H2/t8-/m0/s1 |
| InChIKey | JRDYDOLXGNYOMA-QMMMGPOBSA-N |
| XLogP | 1.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|