C11H16N2O — CID 43115525
2-N-(oxolan-2-ylmethyl)benzene-1,2-diamine (PubChem CID 43115525) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-N-(oxolan-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | 2-N-(oxolan-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43115525 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-N-(oxolan-2-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1NCC1CCCO1 |
| InChI | InChI=1S/C11H16N2O/c12-10-5-1-2-6-11(10)13-8-9-4-3-7-14-9/h1-2,5-6,9,13H,3-4,7-8,12H2 |
| InChIKey | IVWZCXINOWCDRE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|