C13H21N3O — CID 70539842
2-(aminomethyl)-3-methyl-4-N-(oxolan-2-ylmethyl)benzene-1,4-diamine (PubChem CID 70539842) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(aminomethyl)-3-methyl-4-N-(oxolan-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-(aminomethyl)-3-methyl-4-N-(oxolan-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 70539842 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-(aminomethyl)-3-methyl-4-N-(oxolan-2-ylmethyl)benzene-1,4-diamine |
| SMILES | Cc1c(NCC2CCCO2)ccc(N)c1CN |
| InChI | InChI=1S/C13H21N3O/c1-9-11(7-14)12(15)4-5-13(9)16-8-10-3-2-6-17-10/h4-5,10,16H,2-3,6-8,14-15H2,1H3 |
| InChIKey | QBALVAFQDSSTQJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|