C13H16F3NO2 — CID 82833696
N-(oxolan-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 82833696) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-(oxolan-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 82833696 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | FC(F)(F)COc1ccccc1NCC1CCCO1 |
| InChI | InChI=1S/C13H16F3NO2/c14-13(15,16)9-19-12-6-2-1-5-11(12)17-8-10-4-3-7-18-10/h1-2,5-6,10,17H,3-4,7-9H2 |
| InChIKey | NIYXLZVETLOZHR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |