C14H19F3N2O — CID 106633280
N-(piperidin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 106633280) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is N-(piperidin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-(piperidin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 106633280 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-(piperidin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | FC(F)(F)COc1ccccc1NCC1CCCCN1 |
| InChI | InChI=1S/C14H19F3N2O/c15-14(16,17)10-20-13-7-2-1-6-12(13)19-9-11-5-3-4-8-18-11/h1-2,6-7,11,18-19H,3-5,8-10H2 |
| InChIKey | ISDVQUONOPVVFQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |