C14H18F3NO2 — CID 63740369
N-(oxan-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 63740369) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-(oxan-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-(oxan-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 63740369 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(oxan-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | FC(F)(F)COc1ccccc1NCC1CCCOC1 |
| InChI | InChI=1S/C14H18F3NO2/c15-14(16,17)10-20-13-6-2-1-5-12(13)18-8-11-4-3-7-19-9-11/h1-2,5-6,11,18H,3-4,7-10H2 |
| InChIKey | IOPSINLSPCWAAD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |