C11H15N3O3 — CID 178171731
4-amino-N-hydroxy-3-[[(2S)-oxetan-2-yl]methylamino]benzamide (PubChem CID 178171731) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-amino-N-hydroxy-3-[[(2S)-oxetan-2-yl]methylamino]benzamide.
| Compound Name | 4-amino-N-hydroxy-3-[[(2S)-oxetan-2-yl]methylamino]benzamide |
|---|---|
| PubChem CID | 178171731 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-amino-N-hydroxy-3-[[(2S)-oxetan-2-yl]methylamino]benzamide |
| SMILES | Nc1ccc(C(=O)NO)cc1NC[C@@H]1CCO1 |
| InChI | InChI=1S/C11H15N3O3/c12-9-2-1-7(11(15)14-16)5-10(9)13-6-8-3-4-17-8/h1-2,5,8,13,16H,3-4,6,12H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | NGSYICWLWUYAKD-QMMMGPOBSA-N |
| XLogP | 0.59 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|