C13H18N2O — CID 170938453
2-N-[[(2S)-oxetan-2-yl]methyl]-4-[(E)-prop-1-enyl]benzene-1,2-diamine (PubChem CID 170938453) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-N-[[(2S)-oxetan-2-yl]methyl]-4-[(E)-prop-1-enyl]benzene-1,2-diamine.
| Compound Name | 2-N-[[(2S)-oxetan-2-yl]methyl]-4-[(E)-prop-1-enyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 170938453 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-N-[[(2S)-oxetan-2-yl]methyl]-4-[(E)-prop-1-enyl]benzene-1,2-diamine |
| SMILES | C/C=C/c1ccc(N)c(NC[C@@H]2CCO2)c1 |
| InChI | InChI=1S/C13H18N2O/c1-2-3-10-4-5-12(14)13(8-10)15-9-11-6-7-16-11/h2-5,8,11,15H,6-7,9,14H2,1H3/b3-2+/t11-/m0/s1 |
| InChIKey | HBAMFTGBLDCNGI-VUDBWIFFSA-N |
| XLogP | 2.50 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|