C11H13N3O5S — CID 175525593
[4-amino-3-(oxetan-2-ylmethylamino)phenyl] N-sulfonylcarbamate (PubChem CID 175525593) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is [4-amino-3-(oxetan-2-ylmethylamino)phenyl] N-sulfonylcarbamate.
| Compound Name | [4-amino-3-(oxetan-2-ylmethylamino)phenyl] N-sulfonylcarbamate |
|---|---|
| PubChem CID | 175525593 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | [4-amino-3-(oxetan-2-ylmethylamino)phenyl] N-sulfonylcarbamate |
| SMILES | Nc1ccc(OC(=O)N=S(=O)=O)cc1NCC1CCO1 |
| InChI | InChI=1S/C11H13N3O5S/c12-9-2-1-7(19-11(15)14-20(16)17)5-10(9)13-6-8-3-4-18-8/h1-2,5,8,13H,3-4,6,12H2 |
| InChIKey | JVGCVHDWLZIKRP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|