C15H23N3O3 — CID 175450962
[3-amino-4-[[(2S)-oxetan-2-yl]methylamino]phenyl] N-tert-butylcarbamate (PubChem CID 175450962) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is [3-amino-4-[[(2S)-oxetan-2-yl]methylamino]phenyl] N-tert-butylcarbamate.
| Compound Name | [3-amino-4-[[(2S)-oxetan-2-yl]methylamino]phenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175450962 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | [3-amino-4-[[(2S)-oxetan-2-yl]methylamino]phenyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1ccc(NC[C@@H]2CCO2)c(N)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-15(2,3)18-14(19)21-10-4-5-13(12(16)8-10)17-9-11-6-7-20-11/h4-5,8,11,17H,6-7,9,16H2,1-3H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | NMIOBYWLZWOVKB-NSHDSACASA-N |
| XLogP | 2.36 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|