C15H24N4O2 — CID 91003897
[3-amino-4-[(1-methylpiperidin-2-yl)methylamino]phenyl] N-methylcarbamate (PubChem CID 91003897) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is [3-amino-4-[(1-methylpiperidin-2-yl)methylamino]phenyl] N-methylcarbamate.
| Compound Name | [3-amino-4-[(1-methylpiperidin-2-yl)methylamino]phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 91003897 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | [3-amino-4-[(1-methylpiperidin-2-yl)methylamino]phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc(NCC2CCCCN2C)c(N)c1 |
| InChI | InChI=1S/C15H24N4O2/c1-17-15(20)21-12-6-7-14(13(16)9-12)18-10-11-5-3-4-8-19(11)2/h6-7,9,11,18H,3-5,8,10,16H2,1-2H3,(H,17,20) |
| InChIKey | ZUYQDOQKIOCTLM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|