C11H12INO3 — CID 175517386
4-iodo-3-[[(2S)-oxetan-2-yl]methylamino]benzoic acid (PubChem CID 175517386) has the molecular formula C11H12INO3 and a molecular weight of 333.13 g/mol. Its IUPAC name is 4-iodo-3-[[(2S)-oxetan-2-yl]methylamino]benzoic acid.
| Compound Name | 4-iodo-3-[[(2S)-oxetan-2-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 175517386 |
| Molecular Formula | C11H12INO3 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 4-iodo-3-[[(2S)-oxetan-2-yl]methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(I)c(NC[C@@H]2CCO2)c1 |
| InChI | InChI=1S/C11H12INO3/c12-9-2-1-7(11(14)15)5-10(9)13-6-8-3-4-16-8/h1-2,5,8,13H,3-4,6H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | NAUHNUVLCRNTJQ-QMMMGPOBSA-N |
| XLogP | 2.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|