C14H15BrINO4 — CID 175517406
3-[(3-bromo-2-oxopropyl)-[[(2S)-oxetan-2-yl]methyl]amino]-4-iodobenzoic acid (PubChem CID 175517406) has the molecular formula C14H15BrINO4 and a molecular weight of 468.09 g/mol. Its IUPAC name is 3-[(3-bromo-2-oxopropyl)-[[(2S)-oxetan-2-yl]methyl]amino]-4-iodobenzoic acid.
| Compound Name | 3-[(3-bromo-2-oxopropyl)-[[(2S)-oxetan-2-yl]methyl]amino]-4-iodobenzoic acid |
|---|---|
| PubChem CID | 175517406 |
| Molecular Formula | C14H15BrINO4 |
| Molecular Weight | 468.09 g/mol |
| Exact Mass | 466.92 |
| IUPAC Name | 3-[(3-bromo-2-oxopropyl)-[[(2S)-oxetan-2-yl]methyl]amino]-4-iodobenzoic acid |
| SMILES | O=C(CBr)CN(C[C@@H]1CCO1)c1cc(C(=O)O)ccc1I |
| InChI | InChI=1S/C14H15BrINO4/c15-6-10(18)7-17(8-11-3-4-21-11)13-5-9(14(19)20)1-2-12(13)16/h1-2,5,11H,3-4,6-8H2,(H,19,20)/t11-/m0/s1 |
| InChIKey | FWARNOPOWMJFMS-NSHDSACASA-N |
| XLogP | 2.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|