C14H14BrNO4 — CID 175517549
3-(bromomethyl)-4-[[(2S)-oxetan-2-yl]methyl]-1,4-benzoxazine-6-carboxylic acid (PubChem CID 175517549) has the molecular formula C14H14BrNO4 and a molecular weight of 340.17 g/mol. Its IUPAC name is 3-(bromomethyl)-4-[[(2S)-oxetan-2-yl]methyl]-1,4-benzoxazine-6-carboxylic acid.
| Compound Name | 3-(bromomethyl)-4-[[(2S)-oxetan-2-yl]methyl]-1,4-benzoxazine-6-carboxylic acid |
|---|---|
| PubChem CID | 175517549 |
| Molecular Formula | C14H14BrNO4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 3-(bromomethyl)-4-[[(2S)-oxetan-2-yl]methyl]-1,4-benzoxazine-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)N(C[C@@H]1CCO1)C(CBr)=CO2 |
| InChI | InChI=1S/C14H14BrNO4/c15-6-10-8-20-13-2-1-9(14(17)18)5-12(13)16(10)7-11-3-4-19-11/h1-2,5,8,11H,3-4,6-7H2,(H,17,18)/t11-/m0/s1 |
| InChIKey | WTRJLUMSUAXOGQ-NSHDSACASA-N |
| XLogP | 2.61 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|