C17H24N2O5S — CID 99978317
3-(cyclopentylsulfamoyl)-4-[[(2S)-oxolan-2-yl]methylamino]benzoic acid (PubChem CID 99978317) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-4-[[(2S)-oxolan-2-yl]methylamino]benzoic acid.
| Compound Name | 3-(cyclopentylsulfamoyl)-4-[[(2S)-oxolan-2-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 99978317 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-4-[[(2S)-oxolan-2-yl]methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC[C@@H]2CCCO2)c(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H24N2O5S/c20-17(21)12-7-8-15(18-11-14-6-3-9-24-14)16(10-12)25(22,23)19-13-4-1-2-5-13/h7-8,10,13-14,18-19H,1-6,9,11H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | DQWKJWKTBJFYTL-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |