C22H28N2O4S — CID 99978450
3-(cycloheptylsulfamoyl)-4-(2-phenylethylamino)benzoic acid (PubChem CID 99978450) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is 3-(cycloheptylsulfamoyl)-4-(2-phenylethylamino)benzoic acid.
| Compound Name | 3-(cycloheptylsulfamoyl)-4-(2-phenylethylamino)benzoic acid |
|---|---|
| PubChem CID | 99978450 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 3-(cycloheptylsulfamoyl)-4-(2-phenylethylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCCc2ccccc2)c(S(=O)(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C22H28N2O4S/c25-22(26)18-12-13-20(23-15-14-17-8-4-3-5-9-17)21(16-18)29(27,28)24-19-10-6-1-2-7-11-19/h3-5,8-9,12-13,16,19,23-24H,1-2,6-7,10-11,14-15H2,(H,25,26) |
| InChIKey | UCBRIQZYRZPBMN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |