C18H28N2O4S — CID 99978403
3-(cyclohexylsulfamoyl)-4-[[(2S)-pentan-2-yl]amino]benzoic acid (PubChem CID 99978403) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-(cyclohexylsulfamoyl)-4-[[(2S)-pentan-2-yl]amino]benzoic acid.
| Compound Name | 3-(cyclohexylsulfamoyl)-4-[[(2S)-pentan-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 99978403 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-(cyclohexylsulfamoyl)-4-[[(2S)-pentan-2-yl]amino]benzoic acid |
| SMILES | CCC[C@H](C)Nc1ccc(C(=O)O)cc1S(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H28N2O4S/c1-3-7-13(2)19-16-11-10-14(18(21)22)12-17(16)25(23,24)20-15-8-5-4-6-9-15/h10-13,15,19-20H,3-9H2,1-2H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | JHCRJYBTZUNXIZ-ZDUSSCGKSA-N |
| XLogP | 3.60 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |