C17H26N2O4S — CID 99977589
3-(butylsulfamoyl)-4-(cyclohexylamino)benzoic acid (PubChem CID 99977589) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 3-(butylsulfamoyl)-4-(cyclohexylamino)benzoic acid.
| Compound Name | 3-(butylsulfamoyl)-4-(cyclohexylamino)benzoic acid |
|---|---|
| PubChem CID | 99977589 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-(butylsulfamoyl)-4-(cyclohexylamino)benzoic acid |
| SMILES | CCCCNS(=O)(=O)c1cc(C(=O)O)ccc1NC1CCCCC1 |
| InChI | InChI=1S/C17H26N2O4S/c1-2-3-11-18-24(22,23)16-12-13(17(20)21)9-10-15(16)19-14-7-5-4-6-8-14/h9-10,12,14,18-19H,2-8,11H2,1H3,(H,20,21) |
| InChIKey | DIQDWMHFPCVUIB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|