C20H24N2O4S — CID 99979327
4-(cyclopentylamino)-3-(2-phenylethylsulfamoyl)benzoic acid (PubChem CID 99979327) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-(cyclopentylamino)-3-(2-phenylethylsulfamoyl)benzoic acid.
| Compound Name | 4-(cyclopentylamino)-3-(2-phenylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99979327 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(cyclopentylamino)-3-(2-phenylethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(NC2CCCC2)c(S(=O)(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N2O4S/c23-20(24)16-10-11-18(22-17-8-4-5-9-17)19(14-16)27(25,26)21-13-12-15-6-2-1-3-7-15/h1-3,6-7,10-11,14,17,21-22H,4-5,8-9,12-13H2,(H,23,24) |
| InChIKey | OOPUBCASYQMTQO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |