C23H24N2O4S — CID 99979352
4-(2-phenylethylamino)-3-(2-phenylethylsulfamoyl)benzoic acid (PubChem CID 99979352) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is 4-(2-phenylethylamino)-3-(2-phenylethylsulfamoyl)benzoic acid.
| Compound Name | 4-(2-phenylethylamino)-3-(2-phenylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99979352 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-(2-phenylethylamino)-3-(2-phenylethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(NCCc2ccccc2)c(S(=O)(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O4S/c26-23(27)20-11-12-21(24-15-13-18-7-3-1-4-8-18)22(17-20)30(28,29)25-16-14-19-9-5-2-6-10-19/h1-12,17,24-25H,13-16H2,(H,26,27) |
| InChIKey | ZXOYEYSKESIDSY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |