C21H28N2O5S — CID 99980531
4-[2-(4-methoxyphenyl)ethylamino]-3-(pentylsulfamoyl)benzoic acid (PubChem CID 99980531) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)ethylamino]-3-(pentylsulfamoyl)benzoic acid.
| Compound Name | 4-[2-(4-methoxyphenyl)ethylamino]-3-(pentylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99980531 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)ethylamino]-3-(pentylsulfamoyl)benzoic acid |
| SMILES | CCCCCNS(=O)(=O)c1cc(C(=O)O)ccc1NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28N2O5S/c1-3-4-5-13-23-29(26,27)20-15-17(21(24)25)8-11-19(20)22-14-12-16-6-9-18(28-2)10-7-16/h6-11,15,22-23H,3-5,12-14H2,1-2H3,(H,24,25) |
| InChIKey | UIPABCBCVOEXJF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|