C20H26N2O5S — CID 99978018
3-(tert-butylsulfamoyl)-4-[2-(4-methoxyphenyl)ethylamino]benzoic acid (PubChem CID 99978018) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-4-[2-(4-methoxyphenyl)ethylamino]benzoic acid.
| Compound Name | 3-(tert-butylsulfamoyl)-4-[2-(4-methoxyphenyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 99978018 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-4-[2-(4-methoxyphenyl)ethylamino]benzoic acid |
| SMILES | COc1ccc(CCNc2ccc(C(=O)O)cc2S(=O)(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-20(2,3)22-28(25,26)18-13-15(19(23)24)7-10-17(18)21-12-11-14-5-8-16(27-4)9-6-14/h5-10,13,21-22H,11-12H2,1-4H3,(H,23,24) |
| InChIKey | XBWLVULPSWETIC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |