C23H24N2O5S — CID 99979035
3-(benzylsulfamoyl)-4-[2-(4-methoxyphenyl)ethylamino]benzoic acid (PubChem CID 99979035) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-4-[2-(4-methoxyphenyl)ethylamino]benzoic acid.
| Compound Name | 3-(benzylsulfamoyl)-4-[2-(4-methoxyphenyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 99979035 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 3-(benzylsulfamoyl)-4-[2-(4-methoxyphenyl)ethylamino]benzoic acid |
| SMILES | COc1ccc(CCNc2ccc(C(=O)O)cc2S(=O)(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-30-20-10-7-17(8-11-20)13-14-24-21-12-9-19(23(26)27)15-22(21)31(28,29)25-16-18-5-3-2-4-6-18/h2-12,15,24-25H,13-14,16H2,1H3,(H,26,27) |
| InChIKey | VAUXUJDOBIAKSW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |