C20H24N2O5S — CID 99979468
3-[2-(4-methoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylbenzoic acid (PubChem CID 99979468) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylbenzoic acid.
| Compound Name | 3-[2-(4-methoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 99979468 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylbenzoic acid |
| SMILES | COc1ccc(CCNS(=O)(=O)c2cc(C(=O)O)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-27-17-7-4-15(5-8-17)10-11-21-28(25,26)19-14-16(20(23)24)6-9-18(19)22-12-2-3-13-22/h4-9,14,21H,2-3,10-13H2,1H3,(H,23,24) |
| InChIKey | YNFRLRLXBOWCPV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |