C21H28N2O6S — CID 99979525
4-(tert-butylamino)-3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]benzoic acid (PubChem CID 99979525) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is 4-(tert-butylamino)-3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]benzoic acid.
| Compound Name | 4-(tert-butylamino)-3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 99979525 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-(tert-butylamino)-3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]benzoic acid |
| SMILES | COc1ccc(CCNS(=O)(=O)c2cc(C(=O)O)ccc2NC(C)(C)C)cc1OC |
| InChI | InChI=1S/C21H28N2O6S/c1-21(2,3)23-16-8-7-15(20(24)25)13-19(16)30(26,27)22-11-10-14-6-9-17(28-4)18(12-14)29-5/h6-9,12-13,22-23H,10-11H2,1-5H3,(H,24,25) |
| InChIKey | LLTVVOZGOKDKHE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |