C15H24N2O4S — CID 99977977
3-(tert-butylsulfamoyl)-4-(2-methylpropylamino)benzoic acid (PubChem CID 99977977) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-4-(2-methylpropylamino)benzoic acid.
| Compound Name | 3-(tert-butylsulfamoyl)-4-(2-methylpropylamino)benzoic acid |
|---|---|
| PubChem CID | 99977977 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-4-(2-methylpropylamino)benzoic acid |
| SMILES | CC(C)CNc1ccc(C(=O)O)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H24N2O4S/c1-10(2)9-16-12-7-6-11(14(18)19)8-13(12)22(20,21)17-15(3,4)5/h6-8,10,16-17H,9H2,1-5H3,(H,18,19) |
| InChIKey | FBYGVAZQZWOZOQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |